C21H30O5 — CID 11314461
(4aS,9R,9aS)-5,8,9-trihydroxy-6-methoxy-1,1,4a-trimethyl-7-propan-2-yl-2,3,4,9a-tetrahydrofluorene-9-carbaldehyde (PubChem CID 11314461) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is (4aS,9R,9aS)-5,8,9-trihydroxy-6-methoxy-1,1,4a-trimethyl-7-propan-2-yl-2,3,4,9a-tetrahydrofluorene-9-carbaldehyde.
| Compound Name | (4aS,9R,9aS)-5,8,9-trihydroxy-6-methoxy-1,1,4a-trimethyl-7-propan-2-yl-2,3,4,9a-tetrahydrofluorene-9-carbaldehyde |
|---|---|
| PubChem CID | 11314461 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | (4aS,9R,9aS)-5,8,9-trihydroxy-6-methoxy-1,1,4a-trimethyl-7-propan-2-yl-2,3,4,9a-tetrahydrofluorene-9-carbaldehyde |
| SMILES | COc1c(O)c2c(c(O)c1C(C)C)[C@@](O)(C=O)[C@H]1C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C21H30O5/c1-11(2)12-15(23)14-13(16(24)17(12)26-6)20(5)9-7-8-19(3,4)18(20)21(14,25)10-22/h10-11,18,23-25H,7-9H2,1-6H3/t18-,20+,21-/m0/s1 |
| InChIKey | SXTOFVDFNJJCGK-TYPHKJRUSA-N |
| XLogP | 3.71 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|