C21H30O3 — CID 169218692
(4bS,8aS)-3-hydroxy-4-methoxy-4b,8,8-trimethyl-2-propan-2-yl-6,7,8a,10-tetrahydro-5H-phenanthren-9-one (PubChem CID 169218692) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is (4bS,8aS)-3-hydroxy-4-methoxy-4b,8,8-trimethyl-2-propan-2-yl-6,7,8a,10-tetrahydro-5H-phenanthren-9-one.
| Compound Name | (4bS,8aS)-3-hydroxy-4-methoxy-4b,8,8-trimethyl-2-propan-2-yl-6,7,8a,10-tetrahydro-5H-phenanthren-9-one |
|---|---|
| PubChem CID | 169218692 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | (4bS,8aS)-3-hydroxy-4-methoxy-4b,8,8-trimethyl-2-propan-2-yl-6,7,8a,10-tetrahydro-5H-phenanthren-9-one |
| SMILES | COc1c(O)c(C(C)C)cc2c1[C@@]1(C)CCCC(C)(C)[C@@H]1C(=O)C2 |
| InChI | InChI=1S/C21H30O3/c1-12(2)14-10-13-11-15(22)19-20(3,4)8-7-9-21(19,5)16(13)18(24-6)17(14)23/h10,12,19,23H,7-9,11H2,1-6H3/t19-,21+/m0/s1 |
| InChIKey | GOWGTYTVWJDZTJ-PZJWPPBQSA-N |
| XLogP | 4.73 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |