C22H34O4 — CID 74376445
3,10-dimethoxy-4b,8,8-trimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthrene-4,9-diol (PubChem CID 74376445) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is 3,10-dimethoxy-4b,8,8-trimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthrene-4,9-diol.
| Compound Name | 3,10-dimethoxy-4b,8,8-trimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthrene-4,9-diol |
|---|---|
| PubChem CID | 74376445 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 3,10-dimethoxy-4b,8,8-trimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthrene-4,9-diol |
| SMILES | COc1c(C(C)C)cc2c(c1O)C1(C)CCCC(C)(C)C1C(O)C2OC |
| InChI | InChI=1S/C22H34O4/c1-12(2)13-11-14-15(16(23)18(13)25-6)22(5)10-8-9-21(3,4)20(22)17(24)19(14)26-7/h11-12,17,19-20,23-24H,8-10H2,1-7H3 |
| InChIKey | HSNPSWRYBNJNOF-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |