C24H30O6 — CID 163035308
(1R,10S,12S)-3-hydroxy-10-methoxy-7,13,13-trimethyl-4-propan-2-yl-18-oxatetracyclo[9.5.2.01,12.02,9]octadeca-2(9),3,7-triene-5,6,17-trione (PubChem CID 163035308) has the molecular formula C24H30O6 and a molecular weight of 414.50 g/mol. Its IUPAC name is (1R,10S,12S)-3-hydroxy-10-methoxy-7,13,13-trimethyl-4-propan-2-yl-18-oxatetracyclo[9.5.2.01,12.02,9]octadeca-2(9),3,7-triene-5,6,17-trione.
| Compound Name | (1R,10S,12S)-3-hydroxy-10-methoxy-7,13,13-trimethyl-4-propan-2-yl-18-oxatetracyclo[9.5.2.01,12.02,9]octadeca-2(9),3,7-triene-5,6,17-trione |
|---|---|
| PubChem CID | 163035308 |
| Molecular Formula | C24H30O6 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | (1R,10S,12S)-3-hydroxy-10-methoxy-7,13,13-trimethyl-4-propan-2-yl-18-oxatetracyclo[9.5.2.01,12.02,9]octadeca-2(9),3,7-triene-5,6,17-trione |
| SMILES | CO[C@H]1c2cc(C)c(=O)c(=O)c(C(C)C)c(O)c2[C@@]23CCCC(C)(C)[C@@H]2C1OC3=O |
| InChI | InChI=1S/C24H30O6/c1-11(2)14-17(26)15-13(10-12(3)16(25)18(14)27)19(29-6)20-21-23(4,5)8-7-9-24(15,21)22(28)30-20/h10-11,19-21,26H,7-9H2,1-6H3/b12-10-,17-14+/t19-,20?,21-,24-/m0/s1 |
| InChIKey | NOWLWGTULOTUNP-RYIOOJIHSA-N |
| XLogP | 3.24 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|