C19H23ClO4 — CID 122632365
(10S)-5-(1-chloroethyl)-3,4-dihydroxy-11,11-dimethyl-16-oxatetracyclo[6.6.2.01,10.02,7]hexadeca-2,4,6-trien-15-one (PubChem CID 122632365) has the molecular formula C19H23ClO4 and a molecular weight of 350.84 g/mol. Its IUPAC name is (10S)-5-(1-chloroethyl)-3,4-dihydroxy-11,11-dimethyl-16-oxatetracyclo[6.6.2.01,10.02,7]hexadeca-2,4,6-trien-15-one.
| Compound Name | (10S)-5-(1-chloroethyl)-3,4-dihydroxy-11,11-dimethyl-16-oxatetracyclo[6.6.2.01,10.02,7]hexadeca-2,4,6-trien-15-one |
|---|---|
| PubChem CID | 122632365 |
| Molecular Formula | C19H23ClO4 |
| Molecular Weight | 350.84 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | (10S)-5-(1-chloroethyl)-3,4-dihydroxy-11,11-dimethyl-16-oxatetracyclo[6.6.2.01,10.02,7]hexadeca-2,4,6-trien-15-one |
| SMILES | CC(Cl)c1cc2c(c(O)c1O)C13CCCC(C)(C)[C@@H]1CC2OC3=O |
| InChI | InChI=1S/C19H23ClO4/c1-9(20)10-7-11-12-8-13-18(2,3)5-4-6-19(13,17(23)24-12)14(11)16(22)15(10)21/h7,9,12-13,21-22H,4-6,8H2,1-3H3/t9?,12?,13-,19?/m0/s1 |
| InChIKey | JTBCRCYYKJWJGX-CPRZBZNBSA-N |
| XLogP | 4.46 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.84 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|