C21H28O6 — CID 162997327
3,4,13-trihydroxy-8-methoxy-11,11-dimethyl-5-propan-2-yl-16-oxatetracyclo[7.5.2.01,10.02,7]hexadeca-2,4,6-trien-15-one (PubChem CID 162997327) has the molecular formula C21H28O6 and a molecular weight of 376.45 g/mol. Its IUPAC name is 3,4,13-trihydroxy-8-methoxy-11,11-dimethyl-5-propan-2-yl-16-oxatetracyclo[7.5.2.01,10.02,7]hexadeca-2,4,6-trien-15-one.
| Compound Name | 3,4,13-trihydroxy-8-methoxy-11,11-dimethyl-5-propan-2-yl-16-oxatetracyclo[7.5.2.01,10.02,7]hexadeca-2,4,6-trien-15-one |
|---|---|
| PubChem CID | 162997327 |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 3,4,13-trihydroxy-8-methoxy-11,11-dimethyl-5-propan-2-yl-16-oxatetracyclo[7.5.2.01,10.02,7]hexadeca-2,4,6-trien-15-one |
| SMILES | COC1c2cc(C(C)C)c(O)c(O)c2C23CC(O)CC(C)(C)C2C1OC3=O |
| InChI | InChI=1S/C21H28O6/c1-9(2)11-6-12-13(15(24)14(11)23)21-8-10(22)7-20(3,4)18(21)17(16(12)26-5)27-19(21)25/h6,9-10,16-18,22-24H,7-8H2,1-5H3 |
| InChIKey | OPKZBJRGPVMQNF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|