C21H24O5 — CID 100916938
(1R,4S,8R,10S,12S)-10-hydroxy-4,7,13,13-tetramethyl-18-oxapentacyclo[9.5.2.01,12.02,9.04,8]octadeca-2(9),6-diene-3,5,17-trione (PubChem CID 100916938) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is (1R,4S,8R,10S,12S)-10-hydroxy-4,7,13,13-tetramethyl-18-oxapentacyclo[9.5.2.01,12.02,9.04,8]octadeca-2(9),6-diene-3,5,17-trione.
| Compound Name | (1R,4S,8R,10S,12S)-10-hydroxy-4,7,13,13-tetramethyl-18-oxapentacyclo[9.5.2.01,12.02,9.04,8]octadeca-2(9),6-diene-3,5,17-trione |
|---|---|
| PubChem CID | 100916938 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (1R,4S,8R,10S,12S)-10-hydroxy-4,7,13,13-tetramethyl-18-oxapentacyclo[9.5.2.01,12.02,9.04,8]octadeca-2(9),6-diene-3,5,17-trione |
| SMILES | CC1=CC(=O)[C@@]2(C)C(=O)C3=C([C@@H]12)[C@H](O)C1OC(=O)[C@@]32CCCC(C)(C)[C@H]12 |
| InChI | InChI=1S/C21H24O5/c1-9-8-10(22)20(4)12(9)11-13(17(20)24)21-7-5-6-19(2,3)16(21)15(14(11)23)26-18(21)25/h8,12,14-16,23H,5-7H2,1-4H3/t12-,14+,15?,16+,20-,21+/m1/s1 |
| InChIKey | BLFSRDQHSHKSKE-DTBGBSACSA-N |
| XLogP | 2.13 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|