C21H28O5 — CID 25137129
(3aR,5aS,9aS,9bS)-4,5a,9,9-tetramethyl-5-[2-(5-oxo-2H-furan-3-yl)ethyl]-3a,6,7,8,9a,9b-hexahydrobenzo[g][1,3]benzodioxol-2-one (PubChem CID 25137129) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is (3aR,5aS,9aS,9bS)-4,5a,9,9-tetramethyl-5-[2-(5-oxo-2H-furan-3-yl)ethyl]-3a,6,7,8,9a,9b-hexahydrobenzo[g][1,3]benzodioxol-2-one.
| Compound Name | (3aR,5aS,9aS,9bS)-4,5a,9,9-tetramethyl-5-[2-(5-oxo-2H-furan-3-yl)ethyl]-3a,6,7,8,9a,9b-hexahydrobenzo[g][1,3]benzodioxol-2-one |
|---|---|
| PubChem CID | 25137129 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | (3aR,5aS,9aS,9bS)-4,5a,9,9-tetramethyl-5-[2-(5-oxo-2H-furan-3-yl)ethyl]-3a,6,7,8,9a,9b-hexahydrobenzo[g][1,3]benzodioxol-2-one |
| SMILES | CC1=C(CCC2=CC(=O)OC2)[C@@]2(C)CCCC(C)(C)[C@@H]2[C@@H]2OC(=O)O[C@H]12 |
| InChI | InChI=1S/C21H28O5/c1-12-14(7-6-13-10-15(22)24-11-13)21(4)9-5-8-20(2,3)18(21)17-16(12)25-19(23)26-17/h10,16-18H,5-9,11H2,1-4H3/t16-,17-,18+,21-/m1/s1 |
| InChIKey | SFYOHOSSSYBFMD-DCXXXQMHSA-N |
| XLogP | 4.32 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|