C20H30O5 — CID 163017463
3-[2-[(4S,4aR,7S,8aS)-4,7-dihydroxy-2-(hydroxymethyl)-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]ethyl]-2H-furan-5-one (PubChem CID 163017463) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is 3-[2-[(4S,4aR,7S,8aS)-4,7-dihydroxy-2-(hydroxymethyl)-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]ethyl]-2H-furan-5-one.
| Compound Name | 3-[2-[(4S,4aR,7S,8aS)-4,7-dihydroxy-2-(hydroxymethyl)-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]ethyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 163017463 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 3-[2-[(4S,4aR,7S,8aS)-4,7-dihydroxy-2-(hydroxymethyl)-5,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]ethyl]-2H-furan-5-one |
| SMILES | CC1(C)C[C@H](O)C[C@]2(C)C(CCC3=CC(=O)OC3)=C(CO)C[C@H](O)[C@H]12 |
| InChI | InChI=1S/C20H30O5/c1-19(2)8-14(22)9-20(3)15(5-4-12-6-17(24)25-11-12)13(10-21)7-16(23)18(19)20/h6,14,16,18,21-23H,4-5,7-11H2,1-3H3/t14-,16-,18+,20+/m0/s1 |
| InChIKey | AFDSRXAFGCVZJA-LBLLVPRASA-N |
| XLogP | 2.11 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|