C24H34O7 — CID 162852845
[8-acetyloxy-3-hydroxy-1,4a,6-trimethyl-5-[2-(5-oxo-2H-furan-3-yl)ethyl]-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl acetate (PubChem CID 162852845) has the molecular formula C24H34O7 and a molecular weight of 434.53 g/mol. Its IUPAC name is [8-acetyloxy-3-hydroxy-1,4a,6-trimethyl-5-[2-(5-oxo-2H-furan-3-yl)ethyl]-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl acetate.
| Compound Name | [8-acetyloxy-3-hydroxy-1,4a,6-trimethyl-5-[2-(5-oxo-2H-furan-3-yl)ethyl]-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 162852845 |
| Molecular Formula | C24H34O7 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | [8-acetyloxy-3-hydroxy-1,4a,6-trimethyl-5-[2-(5-oxo-2H-furan-3-yl)ethyl]-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl acetate |
| SMILES | CC(=O)OCC1(C)CC(O)CC2(C)C(CCC3=CC(=O)OC3)=C(C)CC(OC(C)=O)C12 |
| InChI | InChI=1S/C24H34O7/c1-14-8-20(31-16(3)26)22-23(4,13-30-15(2)25)10-18(27)11-24(22,5)19(14)7-6-17-9-21(28)29-12-17/h9,18,20,22,27H,6-8,10-13H2,1-5H3 |
| InChIKey | ISERIAVYRUVEJB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|