C33H48O7 — CID 163100977
[(1R,2R,5S,6S,7R,9R,12R,13R)-2,12,13-trihydroxy-5,9-dimethyl-13-[2-(5-oxo-2H-furan-3-yl)ethyl]-5-spiro[4.5]decan-8-yl-7-tricyclo[7.3.1.01,6]tridec-10-enyl] acetate (PubChem CID 163100977) has the molecular formula C33H48O7 and a molecular weight of 556.74 g/mol. Its IUPAC name is [(1R,2R,5S,6S,7R,9R,12R,13R)-2,12,13-trihydroxy-5,9-dimethyl-13-[2-(5-oxo-2H-furan-3-yl)ethyl]-5-spiro[4.5]decan-8-yl-7-tricyclo[7.3.1.01,6]tridec-10-enyl] acetate.
| Compound Name | [(1R,2R,5S,6S,7R,9R,12R,13R)-2,12,13-trihydroxy-5,9-dimethyl-13-[2-(5-oxo-2H-furan-3-yl)ethyl]-5-spiro[4.5]decan-8-yl-7-tricyclo[7.3.1.01,6]tridec-10-enyl] acetate |
|---|---|
| PubChem CID | 163100977 |
| Molecular Formula | C33H48O7 |
| Molecular Weight | 556.74 g/mol |
| Exact Mass | 556.34 |
| IUPAC Name | [(1R,2R,5S,6S,7R,9R,12R,13R)-2,12,13-trihydroxy-5,9-dimethyl-13-[2-(5-oxo-2H-furan-3-yl)ethyl]-5-spiro[4.5]decan-8-yl-7-tricyclo[7.3.1.01,6]tridec-10-enyl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@]2(C)C=C[C@@H](O)[C@@]3([C@H](O)CC[C@@](C)(C4CCC5(CCCC5)CC4)[C@H]13)[C@@]2(O)CCC1=CC(=O)OC1 |
| InChI | InChI=1S/C33H48O7/c1-21(34)40-24-19-29(2)13-9-25(35)33(32(29,38)17-6-22-18-27(37)39-20-22)26(36)10-14-30(3,28(24)33)23-7-15-31(16-8-23)11-4-5-12-31/h9,13,18,23-26,28,35-36,38H,4-8,10-12,14-17,19-20H2,1-3H3/t24-,25-,26-,28+,29+,30+,32-,33+/m1/s1 |
| InChIKey | BIAOHTXFSASICJ-YTQHEGKASA-N |
| XLogP | 4.77 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.74 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|