C35H52O6 — CID 162929979
(1R,2S,3S,6S,7R,8R,9R)-3-cyclohexyl-6,8-dihydroxy-3,9-dimethyl-7-(4-methylpentyl)-8-[2-(5-oxo-2H-furan-3-yl)ethyl]-15-oxatricyclo[7.6.1.02,7]hexadec-10-yn-14-one (PubChem CID 162929979) has the molecular formula C35H52O6 and a molecular weight of 568.80 g/mol. Its IUPAC name is (1R,2S,3S,6S,7R,8R,9R)-3-cyclohexyl-6,8-dihydroxy-3,9-dimethyl-7-(4-methylpentyl)-8-[2-(5-oxo-2H-furan-3-yl)ethyl]-15-oxatricyclo[7.6.1.02,7]hexadec-10-yn-14-one.
| Compound Name | (1R,2S,3S,6S,7R,8R,9R)-3-cyclohexyl-6,8-dihydroxy-3,9-dimethyl-7-(4-methylpentyl)-8-[2-(5-oxo-2H-furan-3-yl)ethyl]-15-oxatricyclo[7.6.1.02,7]hexadec-10-yn-14-one |
|---|---|
| PubChem CID | 162929979 |
| Molecular Formula | C35H52O6 |
| Molecular Weight | 568.80 g/mol |
| Exact Mass | 568.38 |
| IUPAC Name | (1R,2S,3S,6S,7R,8R,9R)-3-cyclohexyl-6,8-dihydroxy-3,9-dimethyl-7-(4-methylpentyl)-8-[2-(5-oxo-2H-furan-3-yl)ethyl]-15-oxatricyclo[7.6.1.02,7]hexadec-10-yn-14-one |
| SMILES | CC(C)CCC[C@]12[C@@H]([C@H]3C[C@](C)(C#CCCC(=O)O3)[C@]1(O)CCC1=CC(=O)OC1)[C@](C)(C1CCCCC1)CC[C@@H]2O |
| InChI | InChI=1S/C35H52O6/c1-24(2)11-10-18-34-28(36)16-19-33(4,26-12-6-5-7-13-26)31(34)27-22-32(3,17-9-8-14-29(37)41-27)35(34,39)20-15-25-21-30(38)40-23-25/h21,24,26-28,31,36,39H,5-8,10-16,18-20,22-23H2,1-4H3/t27-,28+,31+,32+,33+,34+,35-/m1/s1 |
| InChIKey | VEYAZQGOZVOHOW-KOKRQAFDSA-N |
| XLogP | 6.27 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.80 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|