C49H64O7 — CID 162836570
15-cyclopentyl-10,12,25-trihydroxy-15,19-dimethyl-9-(2-methyl-5-phenylpentyl)-25-[2-(5-oxo-2H-furan-3-yl)ethyl]-24-oxapentacyclo[15.5.2.111,19.01,6.011,16]pentacosa-7,20-diyn-23-one (PubChem CID 162836570) has the molecular formula C49H64O7 and a molecular weight of 765.04 g/mol. Its IUPAC name is 15-cyclopentyl-10,12,25-trihydroxy-15,19-dimethyl-9-(2-methyl-5-phenylpentyl)-25-[2-(5-oxo-2H-furan-3-yl)ethyl]-24-oxapentacyclo[15.5.2.111,19.01,6.011,16]pentacosa-7,20-diyn-23-one.
| Compound Name | 15-cyclopentyl-10,12,25-trihydroxy-15,19-dimethyl-9-(2-methyl-5-phenylpentyl)-25-[2-(5-oxo-2H-furan-3-yl)ethyl]-24-oxapentacyclo[15.5.2.111,19.01,6.011,16]pentacosa-7,20-diyn-23-one |
|---|---|
| PubChem CID | 162836570 |
| Molecular Formula | C49H64O7 |
| Molecular Weight | 765.04 g/mol |
| Exact Mass | 764.47 |
| IUPAC Name | 15-cyclopentyl-10,12,25-trihydroxy-15,19-dimethyl-9-(2-methyl-5-phenylpentyl)-25-[2-(5-oxo-2H-furan-3-yl)ethyl]-24-oxapentacyclo[15.5.2.111,19.01,6.011,16]pentacosa-7,20-diyn-23-one |
| SMILES | CC(CCCc1ccccc1)CC1C#CC2CCCCC23CC#CC2(C)CC(OC3=O)C3C(C)(C4CCCC4)CCC(O)C3(C1O)C2(O)CCC1=CC(=O)OC1 |
| InChI | InChI=1S/C49H64O7/c1-33(13-11-16-34-14-5-4-6-15-34)29-36-20-21-38-19-9-10-25-47(38)26-12-24-45(2)31-39(56-44(47)53)42-46(3,37-17-7-8-18-37)27-23-40(50)49(42,43(36)52)48(45,54)28-22-35-30-41(51)55-32-35/h4-6,14-15,30,33,36-40,42-43,50,52,54H,7-11,13,16-19,22-23,25-29,31-32H2,1-3H3 |
| InChIKey | WVVNXUVZBRGMLN-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.04 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|