C51H70O7S2 — CID 162945688
11-benzyl-21-cyclopentyl-16,18,31-trihydroxy-13,21,25-trimethyl-31-[2-(5-oxo-2H-furan-3-yl)ethyl]-30-oxa-8,9-dithiahexacyclo[21.5.2.27,13.117,25.01,6.017,22]tritriacont-26-yn-29-one (PubChem CID 162945688) has the molecular formula C51H70O7S2 and a molecular weight of 859.25 g/mol. Its IUPAC name is 11-benzyl-21-cyclopentyl-16,18,31-trihydroxy-13,21,25-trimethyl-31-[2-(5-oxo-2H-furan-3-yl)ethyl]-30-oxa-8,9-dithiahexacyclo[21.5.2.27,13.117,25.01,6.017,22]tritriacont-26-yn-29-one.
| Compound Name | 11-benzyl-21-cyclopentyl-16,18,31-trihydroxy-13,21,25-trimethyl-31-[2-(5-oxo-2H-furan-3-yl)ethyl]-30-oxa-8,9-dithiahexacyclo[21.5.2.27,13.117,25.01,6.017,22]tritriacont-26-yn-29-one |
|---|---|
| PubChem CID | 162945688 |
| Molecular Formula | C51H70O7S2 |
| Molecular Weight | 859.25 g/mol |
| Exact Mass | 858.46 |
| IUPAC Name | 11-benzyl-21-cyclopentyl-16,18,31-trihydroxy-13,21,25-trimethyl-31-[2-(5-oxo-2H-furan-3-yl)ethyl]-30-oxa-8,9-dithiahexacyclo[21.5.2.27,13.117,25.01,6.017,22]tritriacont-26-yn-29-one |
| SMILES | CC12CCC(SSCC(Cc3ccccc3)C1)C1CCCCC13CC#CC1(C)CC(OC3=O)C3C(C)(C4CCCC4)CCC(O)C3(C(O)CC2)C1(O)CCC1=CC(=O)OC1 |
| InChI | InChI=1S/C51H70O7S2/c1-46-24-18-40(60-59-33-36(30-46)28-34-12-5-4-6-13-34)38-16-9-10-22-49(38)23-11-21-47(2)31-39(58-45(49)55)44-48(3,37-14-7-8-15-37)26-20-42(53)51(44,41(52)19-25-46)50(47,56)27-17-35-29-43(54)57-32-35/h4-6,12-13,29,36-42,44,52-53,56H,7-10,14-20,22-28,30-33H2,1-3H3 |
| InChIKey | PFQMFAVWFGNZIH-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.25 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|