C22H32O6 — CID 162960737
[6-hydroxy-8-(hydroxymethyl)-3,4a,8-trimethyl-4-[2-(5-oxo-2H-furan-3-yl)ethyl]-1,2,5,6,7,8a-hexahydronaphthalen-1-yl] acetate (PubChem CID 162960737) has the molecular formula C22H32O6 and a molecular weight of 392.49 g/mol. Its IUPAC name is [6-hydroxy-8-(hydroxymethyl)-3,4a,8-trimethyl-4-[2-(5-oxo-2H-furan-3-yl)ethyl]-1,2,5,6,7,8a-hexahydronaphthalen-1-yl] acetate.
| Compound Name | [6-hydroxy-8-(hydroxymethyl)-3,4a,8-trimethyl-4-[2-(5-oxo-2H-furan-3-yl)ethyl]-1,2,5,6,7,8a-hexahydronaphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 162960737 |
| Molecular Formula | C22H32O6 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | [6-hydroxy-8-(hydroxymethyl)-3,4a,8-trimethyl-4-[2-(5-oxo-2H-furan-3-yl)ethyl]-1,2,5,6,7,8a-hexahydronaphthalen-1-yl] acetate |
| SMILES | CC(=O)OC1CC(C)=C(CCC2=CC(=O)OC2)C2(C)CC(O)CC(C)(CO)C12 |
| InChI | InChI=1S/C22H32O6/c1-13-7-18(28-14(2)24)20-21(3,12-23)9-16(25)10-22(20,4)17(13)6-5-15-8-19(26)27-11-15/h8,16,18,20,23,25H,5-7,9-12H2,1-4H3 |
| InChIKey | SSHXEFFLUHQYJI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|