C21H26O7 — CID 16664761
methyl (1R,9S,10S)-8-hydroxy-11,11-dimethyl-6,15-dioxo-5-propan-2-yl-7,16-dioxatetracyclo[7.5.2.01,10.03,8]hexadeca-2,4-diene-2-carboxylate (PubChem CID 16664761) has the molecular formula C21H26O7 and a molecular weight of 390.43 g/mol. Its IUPAC name is methyl (1R,9S,10S)-8-hydroxy-11,11-dimethyl-6,15-dioxo-5-propan-2-yl-7,16-dioxatetracyclo[7.5.2.01,10.03,8]hexadeca-2,4-diene-2-carboxylate.
| Compound Name | methyl (1R,9S,10S)-8-hydroxy-11,11-dimethyl-6,15-dioxo-5-propan-2-yl-7,16-dioxatetracyclo[7.5.2.01,10.03,8]hexadeca-2,4-diene-2-carboxylate |
|---|---|
| PubChem CID | 16664761 |
| Molecular Formula | C21H26O7 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | methyl (1R,9S,10S)-8-hydroxy-11,11-dimethyl-6,15-dioxo-5-propan-2-yl-7,16-dioxatetracyclo[7.5.2.01,10.03,8]hexadeca-2,4-diene-2-carboxylate |
| SMILES | COC(=O)C1=C2C=C(C(C)C)C(=O)OC2(O)[C@H]2OC(=O)[C@@]13CCCC(C)(C)[C@H]23 |
| InChI | InChI=1S/C21H26O7/c1-10(2)11-9-12-13(17(23)26-5)20-8-6-7-19(3,4)14(20)15(27-18(20)24)21(12,25)28-16(11)22/h9-10,14-15,25H,6-8H2,1-5H3/t14-,15-,20-,21?/m0/s1 |
| InChIKey | HPQVFSHVHNEXDT-ICSQLKGISA-N |
| XLogP | 2.04 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|