About methyl 5-[1-[(2,2-dimethylcyclopentyl)amino]ethyl]furan-2-carboxylate
methyl 5-[1-[(2,2-dimethylcyclopentyl)amino]ethyl]furan-2-carboxylate (PubChem CID 103256680) has the molecular formula C15H23NO3
and a molecular weight of 265.35 g/mol. Its IUPAC name is methyl 5-[1-[(2,2-dimethylcyclopentyl)amino]ethyl]furan-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[1-[(2,2-dimethylcyclopentyl)amino]ethyl]furan-2-carboxylate |
| PubChem CID | 103256680 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | methyl 5-[1-[(2,2-dimethylcyclopentyl)amino]ethyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(C(C)NC2CCCC2(C)C)o1 |
| InChI | InChI=1S/C15H23NO3/c1-10(16-13-6-5-9-15(13,2)3)11-7-8-12(19-11)14(17)18-4/h7-8,10,13,16H,5-6,9H2,1-4H3 |
| InChIKey | KUSRBVSEVNYGMB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 5-[1-[(2,2-dimethylcyclopentyl)amino]ethyl]furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[1-[(2,2-dimethylcyclopentyl)amino]ethyl]furan-2-carboxylate?
The IUPAC name of methyl 5-[1-[(2,2-dimethylcyclopentyl)amino]ethyl]furan-2-carboxylate (CID 103256680) is methyl 5-[1-[(2,2-dimethylcyclopentyl)amino]ethyl]furan-2-carboxylate.
What is the SMILES notation for methyl 5-[1-[(2,2-dimethylcyclopentyl)amino]ethyl]furan-2-carboxylate?
The canonical SMILES for methyl 5-[1-[(2,2-dimethylcyclopentyl)amino]ethyl]furan-2-carboxylate is COC(=O)c1ccc(C(C)NC2CCCC2(C)C)o1.
What is the InChIKey of methyl 5-[1-[(2,2-dimethylcyclopentyl)amino]ethyl]furan-2-carboxylate?
The InChIKey is KUSRBVSEVNYGMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO3/c1-10(16-13-6-5-9-15(13,2)3)11-7-8-12(19-11)14(17)18-4/h7-8,10,13,16H,5-6,9H2,1-4H3.
What are the key properties of methyl 5-[1-[(2,2-dimethylcyclopentyl)amino]ethyl]furan-2-carboxylate?
methyl 5-[1-[(2,2-dimethylcyclopentyl)amino]ethyl]furan-2-carboxylate has a molecular weight of 265.35 g/mol, XLogP of 3.30, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[1-[(2,2-dimethylcyclopentyl)amino]ethyl]furan-2-carboxylate is sourced from PubChem (CID 103256680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).