C17H19NO3 — CID 103244659
methyl 5-[1-[(2-phenylcyclopropyl)amino]ethyl]furan-2-carboxylate (PubChem CID 103244659) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is methyl 5-[1-[(2-phenylcyclopropyl)amino]ethyl]furan-2-carboxylate.
| Compound Name | methyl 5-[1-[(2-phenylcyclopropyl)amino]ethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 103244659 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | methyl 5-[1-[(2-phenylcyclopropyl)amino]ethyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(C(C)NC2CC2c2ccccc2)o1 |
| InChI | InChI=1S/C17H19NO3/c1-11(15-8-9-16(21-15)17(19)20-2)18-14-10-13(14)12-6-4-3-5-7-12/h3-9,11,13-14,18H,10H2,1-2H3 |
| InChIKey | IMPDBIUEKMYOQK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |