C15H23NO3 — CID 103250815
methyl 5-[1-[(1-methylcyclopentyl)methylamino]ethyl]furan-2-carboxylate (PubChem CID 103250815) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is methyl 5-[1-[(1-methylcyclopentyl)methylamino]ethyl]furan-2-carboxylate.
| Compound Name | methyl 5-[1-[(1-methylcyclopentyl)methylamino]ethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 103250815 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | methyl 5-[1-[(1-methylcyclopentyl)methylamino]ethyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(C(C)NCC2(C)CCCC2)o1 |
| InChI | InChI=1S/C15H23NO3/c1-11(16-10-15(2)8-4-5-9-15)12-6-7-13(19-12)14(17)18-3/h6-7,11,16H,4-5,8-10H2,1-3H3 |
| InChIKey | TUFKZICATMQMMQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |