C20H28O3 — CID 163007863
(4bS,8aR)-4b,8,8-trimethyl-2-propan-2-yl-5,6,7,8a-tetrahydrophenanthrene-1,3,9-triol (PubChem CID 163007863) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (4bS,8aR)-4b,8,8-trimethyl-2-propan-2-yl-5,6,7,8a-tetrahydrophenanthrene-1,3,9-triol.
| Compound Name | (4bS,8aR)-4b,8,8-trimethyl-2-propan-2-yl-5,6,7,8a-tetrahydrophenanthrene-1,3,9-triol |
|---|---|
| PubChem CID | 163007863 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (4bS,8aR)-4b,8,8-trimethyl-2-propan-2-yl-5,6,7,8a-tetrahydrophenanthrene-1,3,9-triol |
| SMILES | CC(C)c1c(O)cc2c(c1O)C=C(O)[C@@H]1C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C20H28O3/c1-11(2)16-14(21)10-13-12(17(16)23)9-15(22)18-19(3,4)7-6-8-20(13,18)5/h9-11,18,21-23H,6-8H2,1-5H3/t18-,20-/m1/s1 |
| InChIKey | HNBTUSPEVSBACH-UYAOXDASSA-N |
| XLogP | 5.22 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |