C19H26O2 — CID 14219316
(6aS,10aS)-7,7,10a-trimethyl-4-propan-2-yl-6a,8,9,10-tetrahydrobenzo[f]isochromen-2-one (PubChem CID 14219316) has the molecular formula C19H26O2 and a molecular weight of 286.42 g/mol. Its IUPAC name is (6aS,10aS)-7,7,10a-trimethyl-4-propan-2-yl-6a,8,9,10-tetrahydrobenzo[f]isochromen-2-one.
| Compound Name | (6aS,10aS)-7,7,10a-trimethyl-4-propan-2-yl-6a,8,9,10-tetrahydrobenzo[f]isochromen-2-one |
|---|---|
| PubChem CID | 14219316 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | (6aS,10aS)-7,7,10a-trimethyl-4-propan-2-yl-6a,8,9,10-tetrahydrobenzo[f]isochromen-2-one |
| SMILES | CC(C)c1oc(=O)cc2c1C=C[C@H]1C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C19H26O2/c1-12(2)17-13-7-8-15-18(3,4)9-6-10-19(15,5)14(13)11-16(20)21-17/h7-8,11-12,15H,6,9-10H2,1-5H3/t15-,19+/m0/s1 |
| InChIKey | HDRBMAQAKPSRJD-HNAYVOBHSA-N |
| XLogP | 4.87 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |