C17H20O4 — CID 10016971
(4aS,10aR)-7,8-dihydroxy-1,1,4a-trimethyl-3,4,10,10a-tetrahydrophenanthrene-2,9-dione (PubChem CID 10016971) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is (4aS,10aR)-7,8-dihydroxy-1,1,4a-trimethyl-3,4,10,10a-tetrahydrophenanthrene-2,9-dione.
| Compound Name | (4aS,10aR)-7,8-dihydroxy-1,1,4a-trimethyl-3,4,10,10a-tetrahydrophenanthrene-2,9-dione |
|---|---|
| PubChem CID | 10016971 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | (4aS,10aR)-7,8-dihydroxy-1,1,4a-trimethyl-3,4,10,10a-tetrahydrophenanthrene-2,9-dione |
| SMILES | CC1(C)C(=O)CC[C@]2(C)c3ccc(O)c(O)c3C(=O)C[C@@H]12 |
| InChI | InChI=1S/C17H20O4/c1-16(2)12-8-11(19)14-9(4-5-10(18)15(14)21)17(12,3)7-6-13(16)20/h4-5,12,18,21H,6-8H2,1-3H3/t12-,17+/m0/s1 |
| InChIKey | SFAIBUCIFDOSEB-YVEFUNNKSA-N |
| XLogP | 2.95 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|