C15H19O5- — CID 6954487
1-(3,4-dimethoxyphenyl)-4-hydroxycyclohexane-1-carboxylate (PubChem CID 6954487) has the molecular formula C15H19O5- and a molecular weight of 279.31 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-4-hydroxycyclohexane-1-carboxylate.
| Compound Name | 1-(3,4-dimethoxyphenyl)-4-hydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 6954487 |
| Molecular Formula | C15H19O5- |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-4-hydroxycyclohexane-1-carboxylate |
| SMILES | COc1ccc(C2(C(=O)[O-])CCC(O)CC2)cc1OC |
| InChI | InChI=1S/C15H20O5/c1-19-12-4-3-10(9-13(12)20-2)15(14(17)18)7-5-11(16)6-8-15/h3-4,9,11,16H,5-8H2,1-2H3,(H,17,18)/p-1 |
| InChIKey | KISUUKAALJRVIS-UHFFFAOYSA-M |
| XLogP | 0.63 |
| TPSA | 78.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |