C16H20O4S — CID 117493405
1-[4-methoxy-3-(thietan-3-yloxy)phenyl]cyclopentane-1-carboxylic acid (PubChem CID 117493405) has the molecular formula C16H20O4S and a molecular weight of 308.40 g/mol. Its IUPAC name is 1-[4-methoxy-3-(thietan-3-yloxy)phenyl]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[4-methoxy-3-(thietan-3-yloxy)phenyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 117493405 |
| Molecular Formula | C16H20O4S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 1-[4-methoxy-3-(thietan-3-yloxy)phenyl]cyclopentane-1-carboxylic acid |
| SMILES | COc1ccc(C2(C(=O)O)CCCC2)cc1OC1CSC1 |
| InChI | InChI=1S/C16H20O4S/c1-19-13-5-4-11(8-14(13)20-12-9-21-10-12)16(15(17)18)6-2-3-7-16/h4-5,8,12H,2-3,6-7,9-10H2,1H3,(H,17,18) |
| InChIKey | XPWFGDVPEHBPSS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |