C14H16O4S — CID 117450144
1-[4-methoxy-3-(thietan-3-yloxy)phenyl]cyclopropane-1-carboxylic acid (PubChem CID 117450144) has the molecular formula C14H16O4S and a molecular weight of 280.34 g/mol. Its IUPAC name is 1-[4-methoxy-3-(thietan-3-yloxy)phenyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[4-methoxy-3-(thietan-3-yloxy)phenyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 117450144 |
| Molecular Formula | C14H16O4S |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 1-[4-methoxy-3-(thietan-3-yloxy)phenyl]cyclopropane-1-carboxylic acid |
| SMILES | COc1ccc(C2(C(=O)O)CC2)cc1OC1CSC1 |
| InChI | InChI=1S/C14H16O4S/c1-17-11-3-2-9(14(4-5-14)13(15)16)6-12(11)18-10-7-19-8-10/h2-3,6,10H,4-5,7-8H2,1H3,(H,15,16) |
| InChIKey | SUOPDKXOEPBPIH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |