C12H22N2O — CID 10727189
(3E,3aR,4R,7aS)-3-hydrazinylidene-3a,7,7-trimethyl-1,2,4,5,6,7a-hexahydroinden-4-ol (PubChem CID 10727189) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is (3E,3aR,4R,7aS)-3-hydrazinylidene-3a,7,7-trimethyl-1,2,4,5,6,7a-hexahydroinden-4-ol.
| Compound Name | (3E,3aR,4R,7aS)-3-hydrazinylidene-3a,7,7-trimethyl-1,2,4,5,6,7a-hexahydroinden-4-ol |
|---|---|
| PubChem CID | 10727189 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | (3E,3aR,4R,7aS)-3-hydrazinylidene-3a,7,7-trimethyl-1,2,4,5,6,7a-hexahydroinden-4-ol |
| SMILES | CC1(C)CC[C@@H](O)[C@@]2(C)/C(=N/N)CC[C@@H]12 |
| InChI | InChI=1S/C12H22N2O/c1-11(2)7-6-10(15)12(3)8(11)4-5-9(12)14-13/h8,10,15H,4-7,13H2,1-3H3/b14-9+/t8-,10+,12+/m0/s1 |
| InChIKey | MZLHBPNWQLSIFY-LYKNXTMQSA-N |
| XLogP | 1.90 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|