C20H28O2 — CID 101266117
(1S,3R,4S,8R,13S)-4-hydroxy-3,7,7-trimethyl-14-methylidenetetracyclo[11.2.1.02,11.03,8]hexadec-2(11)-en-15-one (PubChem CID 101266117) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is (1S,3R,4S,8R,13S)-4-hydroxy-3,7,7-trimethyl-14-methylidenetetracyclo[11.2.1.02,11.03,8]hexadec-2(11)-en-15-one.
| Compound Name | (1S,3R,4S,8R,13S)-4-hydroxy-3,7,7-trimethyl-14-methylidenetetracyclo[11.2.1.02,11.03,8]hexadec-2(11)-en-15-one |
|---|---|
| PubChem CID | 101266117 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (1S,3R,4S,8R,13S)-4-hydroxy-3,7,7-trimethyl-14-methylidenetetracyclo[11.2.1.02,11.03,8]hexadec-2(11)-en-15-one |
| SMILES | C=C1C(=O)[C@H]2C[C@H]1CC1=C2[C@@]2(C)[C@H](CC1)C(C)(C)CC[C@@H]2O |
| InChI | InChI=1S/C20H28O2/c1-11-13-9-12-5-6-15-19(2,3)8-7-16(21)20(15,4)17(12)14(10-13)18(11)22/h13-16,21H,1,5-10H2,2-4H3/t13-,14+,15-,16+,20+/m1/s1 |
| InChIKey | OJXHDPQUDQJCEW-YXTCSXCUSA-N |
| XLogP | 4.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|