C19H28O2 — CID 134954455
(1R,3R,8R,13R,16S)-16-hydroxy-3,7,7-trimethyltetracyclo[11.2.1.02,11.03,8]hexadec-2(11)-en-15-one (PubChem CID 134954455) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is (1R,3R,8R,13R,16S)-16-hydroxy-3,7,7-trimethyltetracyclo[11.2.1.02,11.03,8]hexadec-2(11)-en-15-one.
| Compound Name | (1R,3R,8R,13R,16S)-16-hydroxy-3,7,7-trimethyltetracyclo[11.2.1.02,11.03,8]hexadec-2(11)-en-15-one |
|---|---|
| PubChem CID | 134954455 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (1R,3R,8R,13R,16S)-16-hydroxy-3,7,7-trimethyltetracyclo[11.2.1.02,11.03,8]hexadec-2(11)-en-15-one |
| SMILES | CC1(C)CCC[C@@]2(C)C3=C(CC[C@H]12)C[C@@H]1CC(=O)[C@H]3[C@H]1O |
| InChI | InChI=1S/C19H28O2/c1-18(2)7-4-8-19(3)14(18)6-5-11-9-12-10-13(20)15(16(11)19)17(12)21/h12,14-15,17,21H,4-10H2,1-3H3/t12-,14-,15-,17+,19-/m1/s1 |
| InChIKey | QFZFXGCBCMAHMM-JYJBJNPKSA-N |
| XLogP | 3.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|