C20H26O5 — CID 15275824
(1S,3R,4S,7R,8S,13S)-4-hydroxy-3,7-dimethyl-14-methylidene-15-oxo-16-oxatetracyclo[11.3.1.02,11.03,8]heptadec-2(11)-ene-7-carboxylic acid (PubChem CID 15275824) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is (1S,3R,4S,7R,8S,13S)-4-hydroxy-3,7-dimethyl-14-methylidene-15-oxo-16-oxatetracyclo[11.3.1.02,11.03,8]heptadec-2(11)-ene-7-carboxylic acid.
| Compound Name | (1S,3R,4S,7R,8S,13S)-4-hydroxy-3,7-dimethyl-14-methylidene-15-oxo-16-oxatetracyclo[11.3.1.02,11.03,8]heptadec-2(11)-ene-7-carboxylic acid |
|---|---|
| PubChem CID | 15275824 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | (1S,3R,4S,7R,8S,13S)-4-hydroxy-3,7-dimethyl-14-methylidene-15-oxo-16-oxatetracyclo[11.3.1.02,11.03,8]heptadec-2(11)-ene-7-carboxylic acid |
| SMILES | C=C1C(=O)O[C@H]2C[C@@H]1CC1=C2[C@]2(C)[C@@H](O)CC[C@@](C)(C(=O)O)[C@H]2CC1 |
| InChI | InChI=1S/C20H26O5/c1-10-12-8-11-4-5-14-19(2,18(23)24)7-6-15(21)20(14,3)16(11)13(9-12)25-17(10)22/h12-15,21H,1,4-9H2,2-3H3,(H,23,24)/t12-,13-,14+,15-,19+,20-/m0/s1 |
| InChIKey | CGFRNNVBYXSTHE-GWTKTOIUSA-N |
| XLogP | 2.84 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|