C13H16Br2O — CID 135077134
(3R)-4,4-dibromo-3,7-dimethyltetracyclo[5.4.0.02,9.03,5]undecan-8-one (PubChem CID 135077134) has the molecular formula C13H16Br2O and a molecular weight of 348.08 g/mol. Its IUPAC name is (3R)-4,4-dibromo-3,7-dimethyltetracyclo[5.4.0.02,9.03,5]undecan-8-one.
| Compound Name | (3R)-4,4-dibromo-3,7-dimethyltetracyclo[5.4.0.02,9.03,5]undecan-8-one |
|---|---|
| PubChem CID | 135077134 |
| Molecular Formula | C13H16Br2O |
| Molecular Weight | 348.08 g/mol |
| Exact Mass | 345.96 |
| IUPAC Name | (3R)-4,4-dibromo-3,7-dimethyltetracyclo[5.4.0.02,9.03,5]undecan-8-one |
| SMILES | CC12CC3C(Br)(Br)[C@]3(C)C3C(CCC31)C2=O |
| InChI | InChI=1S/C13H16Br2O/c1-11-5-8-12(2,13(8,14)15)9-6(10(11)16)3-4-7(9)11/h6-9H,3-5H2,1-2H3/t6?,7?,8?,9?,11?,12-/m0/s1 |
| InChIKey | IHLPUDQGMCYRLK-YGULTAHOSA-N |
| XLogP | 3.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.08 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|