C20H30O2Se2 — CID 10895811
(1R,3S,4S)-1,7,7-trimethyl-3-[[(1S,2S,4R)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]diselanyl]bicyclo[2.2.1]heptan-2-one (PubChem CID 10895811) has the molecular formula C20H30O2Se2 and a molecular weight of 460.38 g/mol. Its IUPAC name is (1R,3S,4S)-1,7,7-trimethyl-3-[[(1S,2S,4R)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]diselanyl]bicyclo[2.2.1]heptan-2-one.
| Compound Name | (1R,3S,4S)-1,7,7-trimethyl-3-[[(1S,2S,4R)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]diselanyl]bicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 10895811 |
| Molecular Formula | C20H30O2Se2 |
| Molecular Weight | 460.38 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | (1R,3S,4S)-1,7,7-trimethyl-3-[[(1S,2S,4R)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]diselanyl]bicyclo[2.2.1]heptan-2-one |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)C(=O)[C@H]2[Se][Se][C@@H]1C(=O)[C@]2(C)CC[C@H]1C2(C)C |
| InChI | InChI=1S/C20H30O2Se2/c1-17(2)11-7-9-19(17,5)15(21)13(11)23-24-14-12-8-10-20(6,16(14)22)18(12,3)4/h11-14H,7-10H2,1-6H3/t11-,12-,13+,14+,19+,20+/m1/s1 |
| InChIKey | NZSTXQPMIGEJQU-JWRMFUQSSA-N |
| XLogP | 3.94 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|