C16H28O2Se — CID 10758879
(1R,3S,4S)-3-[(3R,4S)-4-hydroxyhexan-3-yl]selanyl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 10758879) has the molecular formula C16H28O2Se and a molecular weight of 331.36 g/mol. Its IUPAC name is (1R,3S,4S)-3-[(3R,4S)-4-hydroxyhexan-3-yl]selanyl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | (1R,3S,4S)-3-[(3R,4S)-4-hydroxyhexan-3-yl]selanyl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 10758879 |
| Molecular Formula | C16H28O2Se |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | (1R,3S,4S)-3-[(3R,4S)-4-hydroxyhexan-3-yl]selanyl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CC[C@H](O)[C@@H](CC)[Se][C@@H]1C(=O)[C@]2(C)CC[C@H]1C2(C)C |
| InChI | InChI=1S/C16H28O2Se/c1-6-11(17)12(7-2)19-13-10-8-9-16(5,14(13)18)15(10,3)4/h10-13,17H,6-9H2,1-5H3/t10-,11+,12-,13+,16+/m1/s1 |
| InChIKey | CAKKCBHJUYMVNE-CRQFQMBKSA-N |
| XLogP | 3.47 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|