C28H32O4Se — CID 102207858
methyl (2R,3R)-5-oxo-3,5-diphenyl-2-[(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)selanyl]pentanoate (PubChem CID 102207858) has the molecular formula C28H32O4Se and a molecular weight of 511.52 g/mol. Its IUPAC name is methyl (2R,3R)-5-oxo-3,5-diphenyl-2-[(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)selanyl]pentanoate.
| Compound Name | methyl (2R,3R)-5-oxo-3,5-diphenyl-2-[(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)selanyl]pentanoate |
|---|---|
| PubChem CID | 102207858 |
| Molecular Formula | C28H32O4Se |
| Molecular Weight | 511.52 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | methyl (2R,3R)-5-oxo-3,5-diphenyl-2-[(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)selanyl]pentanoate |
| SMILES | COC(=O)[C@H]([Se]C1C(=O)C2(C)CCC1C2(C)C)[C@H](CC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H32O4Se/c1-27(2)21-15-16-28(27,3)25(30)24(21)33-23(26(31)32-4)20(18-11-7-5-8-12-18)17-22(29)19-13-9-6-10-14-19/h5-14,20-21,23-24H,15-17H2,1-4H3/t20-,21?,23-,24?,28?/m1/s1 |
| InChIKey | UKQGYMYXAWLZBU-HGCNYCQQSA-N |
| XLogP | 5.52 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.52 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|