C18H24O2Se — CID 10521865
(1R,3S,4S)-3-[(2S)-2-hydroxy-2-phenylethyl]selanyl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 10521865) has the molecular formula C18H24O2Se and a molecular weight of 351.35 g/mol. Its IUPAC name is (1R,3S,4S)-3-[(2S)-2-hydroxy-2-phenylethyl]selanyl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | (1R,3S,4S)-3-[(2S)-2-hydroxy-2-phenylethyl]selanyl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 10521865 |
| Molecular Formula | C18H24O2Se |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | (1R,3S,4S)-3-[(2S)-2-hydroxy-2-phenylethyl]selanyl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)C(=O)[C@H]2[Se]C[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C18H24O2Se/c1-17(2)13-9-10-18(17,3)16(20)15(13)21-11-14(19)12-7-5-4-6-8-12/h4-8,13-15,19H,9-11H2,1-3H3/t13-,14-,15+,18+/m1/s1 |
| InChIKey | KQKMBWHTQSQVPE-BSXFFOKHSA-N |
| XLogP | 3.66 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|