C22H25OP — CID 102250401
(1S,3R,4S)-3-diphenylphosphanyl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 102250401) has the molecular formula C22H25OP and a molecular weight of 336.42 g/mol. Its IUPAC name is (1S,3R,4S)-3-diphenylphosphanyl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | (1S,3R,4S)-3-diphenylphosphanyl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 102250401 |
| Molecular Formula | C22H25OP |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | (1S,3R,4S)-3-diphenylphosphanyl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CC1(C)[C@@H]2CC[C@]1(C)C(=O)[C@@H]2P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H25OP/c1-21(2)18-14-15-22(21,3)20(23)19(18)24(16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13,18-19H,14-15H2,1-3H3/t18-,19-,22-/m1/s1 |
| InChIKey | TWMVZZSFPQEVRP-WOIUINJBSA-N |
| XLogP | 4.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|