C23H26O — CID 7053658
(1S,3R,4S)-3-benzhydryl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 7053658) has the molecular formula C23H26O and a molecular weight of 318.46 g/mol. Its IUPAC name is (1S,3R,4S)-3-benzhydryl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | (1S,3R,4S)-3-benzhydryl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 7053658 |
| Molecular Formula | C23H26O |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | (1S,3R,4S)-3-benzhydryl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)C(=O)[C@H]2C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H26O/c1-22(2)18-14-15-23(22,3)21(24)20(18)19(16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13,18-20H,14-15H2,1-3H3/t18-,20+,23+/m0/s1 |
| InChIKey | KRVVIJQGWHRMOM-JXHRLWIKSA-N |
| XLogP | 5.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |