C23H28O — CID 91115294
(1R)-3-benzhydryl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol (PubChem CID 91115294) has the molecular formula C23H28O and a molecular weight of 320.48 g/mol. Its IUPAC name is (1R)-3-benzhydryl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol.
| Compound Name | (1R)-3-benzhydryl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 91115294 |
| Molecular Formula | C23H28O |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | (1R)-3-benzhydryl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
| SMILES | CC1(C)C2CC[C@@]1(C)C(O)C2C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H28O/c1-22(2)18-14-15-23(22,3)21(24)20(18)19(16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13,18-21,24H,14-15H2,1-3H3/t18?,20?,21?,23-/m0/s1 |
| InChIKey | AVDVYMLVSQDTMG-HGICKYPLSA-N |
| XLogP | 5.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |