C17H24O3S — CID 10828640
(1R,2S,3R,4S)-3-benzylsulfonyl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol (PubChem CID 10828640) has the molecular formula C17H24O3S and a molecular weight of 308.44 g/mol. Its IUPAC name is (1R,2S,3R,4S)-3-benzylsulfonyl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol.
| Compound Name | (1R,2S,3R,4S)-3-benzylsulfonyl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 10828640 |
| Molecular Formula | C17H24O3S |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | (1R,2S,3R,4S)-3-benzylsulfonyl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@H](O)[C@@H]2S(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C17H24O3S/c1-16(2)13-9-10-17(16,3)15(18)14(13)21(19,20)11-12-7-5-4-6-8-12/h4-8,13-15,18H,9-11H2,1-3H3/t13-,14-,15-,17+/m1/s1 |
| InChIKey | GKRXGOJROADRCD-ANQUJSFKSA-N |
| XLogP | 2.79 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |