C15H26O2Se — CID 10495682
(1R,3S,4S)-3-(3-methoxybutan-2-ylselanyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 10495682) has the molecular formula C15H26O2Se and a molecular weight of 317.33 g/mol. Its IUPAC name is (1R,3S,4S)-3-(3-methoxybutan-2-ylselanyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | (1R,3S,4S)-3-(3-methoxybutan-2-ylselanyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 10495682 |
| Molecular Formula | C15H26O2Se |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | (1R,3S,4S)-3-(3-methoxybutan-2-ylselanyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | COC(C)C(C)[Se][C@@H]1C(=O)[C@]2(C)CC[C@H]1C2(C)C |
| InChI | InChI=1S/C15H26O2Se/c1-9(17-6)10(2)18-12-11-7-8-15(5,13(12)16)14(11,3)4/h9-12H,7-8H2,1-6H3/t9?,10?,11-,12+,15+/m1/s1 |
| InChIKey | BHFZFVYZDZXLCY-KRYNXGPFSA-N |
| XLogP | 3.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|