C22H34O2 — CID 124768639
(1S,3S,4R)-1,7,7-trimethyl-3-[2-[(1S,2S,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]ethyl]bicyclo[2.2.1]heptan-2-one (PubChem CID 124768639) has the molecular formula C22H34O2 and a molecular weight of 330.51 g/mol. Its IUPAC name is (1S,3S,4R)-1,7,7-trimethyl-3-[2-[(1S,2S,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]ethyl]bicyclo[2.2.1]heptan-2-one.
| Compound Name | (1S,3S,4R)-1,7,7-trimethyl-3-[2-[(1S,2S,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]ethyl]bicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 124768639 |
| Molecular Formula | C22H34O2 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | (1S,3S,4R)-1,7,7-trimethyl-3-[2-[(1S,2S,4S)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl]ethyl]bicyclo[2.2.1]heptan-2-one |
| SMILES | CC1(C)[C@@H]2CC[C@]1(C)C(=O)[C@H]2CC[C@@H]1C(=O)[C@@]2(C)CC[C@@H]1C2(C)C |
| InChI | InChI=1S/C22H34O2/c1-19(2)15-9-11-21(19,5)17(23)13(15)7-8-14-16-10-12-22(6,18(14)24)20(16,3)4/h13-16H,7-12H2,1-6H3/t13-,14-,15-,16+,21+,22+/m0/s1 |
| InChIKey | QMOPYIPYDKCJRB-SELGYLMWSA-N |
| XLogP | 5.05 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |