C25H48ClN — CID 175225393
methyl(tripropyl)azanium;3,3,7-trimethyl-8-methylidenetricyclo[5.4.0.02,9]undecane;chloride (PubChem CID 175225393) has the molecular formula C25H48ClN and a molecular weight of 398.12 g/mol. Its IUPAC name is methyl(tripropyl)azanium;3,3,7-trimethyl-8-methylidenetricyclo[5.4.0.02,9]undecane;chloride.
| Compound Name | methyl(tripropyl)azanium;3,3,7-trimethyl-8-methylidenetricyclo[5.4.0.02,9]undecane;chloride |
|---|---|
| PubChem CID | 175225393 |
| Molecular Formula | C25H48ClN |
| Molecular Weight | 398.12 g/mol |
| Exact Mass | 397.35 |
| IUPAC Name | methyl(tripropyl)azanium;3,3,7-trimethyl-8-methylidenetricyclo[5.4.0.02,9]undecane;chloride |
| SMILES | C=C1C2CCC3C2C(C)(C)CCCC13C.CCC[N+](C)(CCC)CCC.[Cl-] |
| InChI | InChI=1S/C15H24.C10H24N.ClH/c1-10-11-6-7-12-13(11)14(2,3)8-5-9-15(10,12)4;1-5-8-11(4,9-6-2)10-7-3;/h11-13H,1,5-9H2,2-4H3;5-10H2,1-4H3;1H/q;+1;/p-1 |
| InChIKey | PXDQMDPMTDNYQR-UHFFFAOYSA-M |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.12 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|