C51H90O2 — CID 157329551
2,3-dimethyl-2-[(3-methyl-2-bicyclo[2.2.1]heptanyl)methyl]bicyclo[2.2.1]heptane;3,5,5-trimethylhexyl 3,5,5-trimethylhexanoate;3,3,7-trimethyl-8-methylidenetricyclo[5.4.0.02,9]undecane (PubChem CID 157329551) has the molecular formula C51H90O2 and a molecular weight of 735.28 g/mol. Its IUPAC name is 2,3-dimethyl-2-[(3-methyl-2-bicyclo[2.2.1]heptanyl)methyl]bicyclo[2.2.1]heptane;3,5,5-trimethylhexyl 3,5,5-trimethylhexanoate;3,3,7-trimethyl-8-methylidenetricyclo[5.4.0.02,9]undecane.
| Compound Name | 2,3-dimethyl-2-[(3-methyl-2-bicyclo[2.2.1]heptanyl)methyl]bicyclo[2.2.1]heptane;3,5,5-trimethylhexyl 3,5,5-trimethylhexanoate;3,3,7-trimethyl-8-methylidenetricyclo[5.4.0.02,9]undecane |
|---|---|
| PubChem CID | 157329551 |
| Molecular Formula | C51H90O2 |
| Molecular Weight | 735.28 g/mol |
| Exact Mass | 734.69 |
| IUPAC Name | 2,3-dimethyl-2-[(3-methyl-2-bicyclo[2.2.1]heptanyl)methyl]bicyclo[2.2.1]heptane;3,5,5-trimethylhexyl 3,5,5-trimethylhexanoate;3,3,7-trimethyl-8-methylidenetricyclo[5.4.0.02,9]undecane |
| SMILES | C=C1C2CCC3C2C(C)(C)CCCC13C.CC(CCOC(=O)CC(C)CC(C)(C)C)CC(C)(C)C.CC1C2CCC(C2)C1CC1(C)C2CCC(C2)C1C |
| InChI | InChI=1S/C18H36O2.C18H30.C15H24/c1-14(12-17(3,4)5)9-10-20-16(19)11-15(2)13-18(6,7)8;1-11-13-4-5-15(8-13)17(11)10-18(3)12(2)14-6-7-16(18)9-14;1-10-11-6-7-12-13(11)14(2,3)8-5-9-15(10,12)4/h14-15H,9-13H2,1-8H3;11-17H,4-10H2,1-3H3;11-13H,1,5-9H2,2-4H3 |
| InChIKey | BFCXRHJMBQNTOA-UHFFFAOYSA-N |
| XLogP | 15.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.28 |
| LogP ≤ 5 | 15.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|