C20H33NO — CID 15966307
(E)-N-propoxy-1-[(1R,2R,7S,9S)-3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanylidene]propan-2-imine (PubChem CID 15966307) has the molecular formula C20H33NO and a molecular weight of 303.49 g/mol. Its IUPAC name is (E)-N-propoxy-1-[(1R,2R,7S,9S)-3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanylidene]propan-2-imine.
| Compound Name | (E)-N-propoxy-1-[(1R,2R,7S,9S)-3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanylidene]propan-2-imine |
|---|---|
| PubChem CID | 15966307 |
| Molecular Formula | C20H33NO |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.26 |
| IUPAC Name | (E)-N-propoxy-1-[(1R,2R,7S,9S)-3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanylidene]propan-2-imine |
| SMILES | CCCO/N=C(\C)C=C1[C@H]2CC[C@@H]3[C@H]2C(C)(C)CCC[C@]13C |
| InChI | InChI=1S/C20H33NO/c1-6-12-22-21-14(2)13-17-15-8-9-16-18(15)19(3,4)10-7-11-20(16,17)5/h13,15-16,18H,6-12H2,1-5H3/b17-13?,21-14+/t15-,16-,18+,20+/m1/s1 |
| InChIKey | RMWSHIKXQXYPAJ-FZNQPCQRSA-N |
| XLogP | 5.59 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|