C20H28O3 — CID 163052777
5,5,9-trimethyl-17-methylidene-15-oxatetracyclo[11.2.2.01,14.04,9]heptadecane-10,16-dione (PubChem CID 163052777) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is 5,5,9-trimethyl-17-methylidene-15-oxatetracyclo[11.2.2.01,14.04,9]heptadecane-10,16-dione.
| Compound Name | 5,5,9-trimethyl-17-methylidene-15-oxatetracyclo[11.2.2.01,14.04,9]heptadecane-10,16-dione |
|---|---|
| PubChem CID | 163052777 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 5,5,9-trimethyl-17-methylidene-15-oxatetracyclo[11.2.2.01,14.04,9]heptadecane-10,16-dione |
| SMILES | C=C1C(=O)C23CCC4C(C)(C)CCCC4(C)C(=O)CCC1C2O3 |
| InChI | InChI=1S/C20H28O3/c1-12-13-6-7-15(21)19(4)10-5-9-18(2,3)14(19)8-11-20(16(12)22)17(13)23-20/h13-14,17H,1,5-11H2,2-4H3 |
| InChIKey | UJADOEWLIVXNII-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|