C23H32O6 — CID 98560815
[(1S,2R,4S,6S,9R,13S,14R)-2-methoxy-5,5,9-trimethyl-17-methylidene-10,16-dioxo-15-oxatetracyclo[11.2.2.01,14.04,9]heptadecan-6-yl] acetate (PubChem CID 98560815) has the molecular formula C23H32O6 and a molecular weight of 404.50 g/mol. Its IUPAC name is [(1S,2R,4S,6S,9R,13S,14R)-2-methoxy-5,5,9-trimethyl-17-methylidene-10,16-dioxo-15-oxatetracyclo[11.2.2.01,14.04,9]heptadecan-6-yl] acetate.
| Compound Name | [(1S,2R,4S,6S,9R,13S,14R)-2-methoxy-5,5,9-trimethyl-17-methylidene-10,16-dioxo-15-oxatetracyclo[11.2.2.01,14.04,9]heptadecan-6-yl] acetate |
|---|---|
| PubChem CID | 98560815 |
| Molecular Formula | C23H32O6 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | [(1S,2R,4S,6S,9R,13S,14R)-2-methoxy-5,5,9-trimethyl-17-methylidene-10,16-dioxo-15-oxatetracyclo[11.2.2.01,14.04,9]heptadecan-6-yl] acetate |
| SMILES | C=C1C(=O)[C@@]23O[C@@H]2[C@H]1CCC(=O)[C@]1(C)CC[C@H](OC(C)=O)C(C)(C)[C@@H]1C[C@H]3OC |
| InChI | InChI=1S/C23H32O6/c1-12-14-7-8-16(25)22(5)10-9-17(28-13(2)24)21(3,4)15(22)11-18(27-6)23(19(12)26)20(14)29-23/h14-15,17-18,20H,1,7-11H2,2-6H3/t14-,15-,17-,18+,20+,22+,23+/m0/s1 |
| InChIKey | YNYRYHKHEQKTSS-QSPCYIFNSA-N |
| XLogP | 3.02 |
| TPSA | 82.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|