C29H38O6 — CID 10928966
(1R,2R,4R,6S,9R,13S,14R)-2-methoxy-6-[(4-methoxyphenyl)methoxy]-5,5,9-trimethyl-17-methylidene-15-oxatetracyclo[11.2.2.01,14.04,9]heptadecane-10,16-dione (PubChem CID 10928966) has the molecular formula C29H38O6 and a molecular weight of 482.62 g/mol. Its IUPAC name is (1R,2R,4R,6S,9R,13S,14R)-2-methoxy-6-[(4-methoxyphenyl)methoxy]-5,5,9-trimethyl-17-methylidene-15-oxatetracyclo[11.2.2.01,14.04,9]heptadecane-10,16-dione.
| Compound Name | (1R,2R,4R,6S,9R,13S,14R)-2-methoxy-6-[(4-methoxyphenyl)methoxy]-5,5,9-trimethyl-17-methylidene-15-oxatetracyclo[11.2.2.01,14.04,9]heptadecane-10,16-dione |
|---|---|
| PubChem CID | 10928966 |
| Molecular Formula | C29H38O6 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | (1R,2R,4R,6S,9R,13S,14R)-2-methoxy-6-[(4-methoxyphenyl)methoxy]-5,5,9-trimethyl-17-methylidene-15-oxatetracyclo[11.2.2.01,14.04,9]heptadecane-10,16-dione |
| SMILES | C=C1C(=O)[C@]23O[C@@H]2[C@H]1CCC(=O)[C@]1(C)CC[C@H](OCc2ccc(OC)cc2)C(C)(C)[C@H]1C[C@H]3OC |
| InChI | InChI=1S/C29H38O6/c1-17-20-11-12-22(30)28(4)14-13-23(34-16-18-7-9-19(32-5)10-8-18)27(2,3)21(28)15-24(33-6)29(25(17)31)26(20)35-29/h7-10,20-21,23-24,26H,1,11-16H2,2-6H3/t20-,21+,23-,24+,26+,28+,29-/m0/s1 |
| InChIKey | OKLVELGUNGFEES-VOPRCFQYSA-N |
| XLogP | 4.68 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|