C25H34O5 — CID 53343296
[(1S,4aR,5S,6S,8aS)-5-formyl-6-[(4-methoxyphenyl)methoxy]-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl acetate (PubChem CID 53343296) has the molecular formula C25H34O5 and a molecular weight of 414.54 g/mol. Its IUPAC name is [(1S,4aR,5S,6S,8aS)-5-formyl-6-[(4-methoxyphenyl)methoxy]-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl acetate.
| Compound Name | [(1S,4aR,5S,6S,8aS)-5-formyl-6-[(4-methoxyphenyl)methoxy]-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 53343296 |
| Molecular Formula | C25H34O5 |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | [(1S,4aR,5S,6S,8aS)-5-formyl-6-[(4-methoxyphenyl)methoxy]-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl acetate |
| SMILES | C=C1CC[C@H]2[C@](C)(C=O)[C@@H](OCc3ccc(OC)cc3)CC[C@]2(C)[C@H]1COC(C)=O |
| InChI | InChI=1S/C25H34O5/c1-17-6-11-22-24(3,21(17)15-29-18(2)27)13-12-23(25(22,4)16-26)30-14-19-7-9-20(28-5)10-8-19/h7-10,16,21-23H,1,6,11-15H2,2-5H3/t21-,22+,23-,24+,25-/m0/s1 |
| InChIKey | PXPZYRPTNOMUIQ-KKGFQHLNSA-N |
| XLogP | 4.73 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|