C31H42O4 — CID 71475326
(3R,4R,4aR,8R,8aR)-4,8-bis[(4-methoxyphenyl)methoxy]-8a-methyl-5-methylidene-3-propan-2-yl-1,2,3,4,4a,6,7,8-octahydronaphthalene (PubChem CID 71475326) has the molecular formula C31H42O4 and a molecular weight of 478.67 g/mol. Its IUPAC name is (3R,4R,4aR,8R,8aR)-4,8-bis[(4-methoxyphenyl)methoxy]-8a-methyl-5-methylidene-3-propan-2-yl-1,2,3,4,4a,6,7,8-octahydronaphthalene.
| Compound Name | (3R,4R,4aR,8R,8aR)-4,8-bis[(4-methoxyphenyl)methoxy]-8a-methyl-5-methylidene-3-propan-2-yl-1,2,3,4,4a,6,7,8-octahydronaphthalene |
|---|---|
| PubChem CID | 71475326 |
| Molecular Formula | C31H42O4 |
| Molecular Weight | 478.67 g/mol |
| Exact Mass | 478.31 |
| IUPAC Name | (3R,4R,4aR,8R,8aR)-4,8-bis[(4-methoxyphenyl)methoxy]-8a-methyl-5-methylidene-3-propan-2-yl-1,2,3,4,4a,6,7,8-octahydronaphthalene |
| SMILES | C=C1CC[C@@H](OCc2ccc(OC)cc2)[C@]2(C)CC[C@H](C(C)C)[C@@H](OCc3ccc(OC)cc3)[C@H]12 |
| InChI | InChI=1S/C31H42O4/c1-21(2)27-17-18-31(4)28(34-19-23-8-12-25(32-5)13-9-23)16-7-22(3)29(31)30(27)35-20-24-10-14-26(33-6)15-11-24/h8-15,21,27-30H,3,7,16-20H2,1-2,4-6H3/t27-,28-,29+,30-,31+/m1/s1 |
| InChIKey | KDRQQOVSVXGOSY-SAEUYMBFSA-N |
| XLogP | 7.21 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.67 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|