C18H26O4 — CID 11974076
(2S,4S,6S)-6-ethenyl-2-methoxy-4-[(4-methoxyphenyl)methoxy]-3,3-dimethyloxane (PubChem CID 11974076) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is (2S,4S,6S)-6-ethenyl-2-methoxy-4-[(4-methoxyphenyl)methoxy]-3,3-dimethyloxane.
| Compound Name | (2S,4S,6S)-6-ethenyl-2-methoxy-4-[(4-methoxyphenyl)methoxy]-3,3-dimethyloxane |
|---|---|
| PubChem CID | 11974076 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | (2S,4S,6S)-6-ethenyl-2-methoxy-4-[(4-methoxyphenyl)methoxy]-3,3-dimethyloxane |
| SMILES | C=C[C@@H]1C[C@H](OCc2ccc(OC)cc2)C(C)(C)[C@@H](OC)O1 |
| InChI | InChI=1S/C18H26O4/c1-6-14-11-16(18(2,3)17(20-5)22-14)21-12-13-7-9-15(19-4)10-8-13/h6-10,14,16-17H,1,11-12H2,2-5H3/t14-,16+,17+/m1/s1 |
| InChIKey | GDRSPTIQTOJTPA-PVAVHDDUSA-N |
| XLogP | 3.55 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|