C20H28O4 — CID 73228234
2-hydroxy-5,5,9-trimethyl-17-methylidene-15-oxatetracyclo[11.2.2.01,14.04,9]heptadecane-10,16-dione (PubChem CID 73228234) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is 2-hydroxy-5,5,9-trimethyl-17-methylidene-15-oxatetracyclo[11.2.2.01,14.04,9]heptadecane-10,16-dione.
| Compound Name | 2-hydroxy-5,5,9-trimethyl-17-methylidene-15-oxatetracyclo[11.2.2.01,14.04,9]heptadecane-10,16-dione |
|---|---|
| PubChem CID | 73228234 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 2-hydroxy-5,5,9-trimethyl-17-methylidene-15-oxatetracyclo[11.2.2.01,14.04,9]heptadecane-10,16-dione |
| SMILES | C=C1C(=O)C23OC2C1CCC(=O)C1(C)CCCC(C)(C)C1CC3O |
| InChI | InChI=1S/C20H28O4/c1-11-12-6-7-14(21)19(4)9-5-8-18(2,3)13(19)10-15(22)20(16(11)23)17(12)24-20/h12-13,15,17,22H,1,5-10H2,2-4H3 |
| InChIKey | FMJYLEICZDKMFF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 66.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|